C32H34N4O2 — CID 54245505
1-cyano-2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-(2-phenylethyl)guanidine (PubChem CID 54245505) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 1-cyano-2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-(2-phenylethyl)guanidine.
| Compound Name | 1-cyano-2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 54245505 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 1-cyano-2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]-3-(2-phenylethyl)guanidine |
| SMILES | COc1ccc(C(C#Cc2ccccc2)C/N=C(\NC#N)NCCc2ccccc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C32H34N4O2/c1-37-30-19-18-27(22-31(30)38-29-14-8-9-15-29)28(17-16-25-10-4-2-5-11-25)23-35-32(36-24-33)34-21-20-26-12-6-3-7-13-26/h2-7,10-13,18-19,22,28-29H,8-9,14-15,20-21,23H2,1H3,(H2,34,35,36) |
| InChIKey | QSZYZXHGKOBAQO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|