C27H32N4O2 — CID 57183710
1-cyano-2-[2-[3-(2-cyclohexylethoxy)-4-methoxyphenyl]-4-phenylbut-3-ynyl]guanidine (PubChem CID 57183710) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-cyano-2-[2-[3-(2-cyclohexylethoxy)-4-methoxyphenyl]-4-phenylbut-3-ynyl]guanidine.
| Compound Name | 1-cyano-2-[2-[3-(2-cyclohexylethoxy)-4-methoxyphenyl]-4-phenylbut-3-ynyl]guanidine |
|---|---|
| PubChem CID | 57183710 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 1-cyano-2-[2-[3-(2-cyclohexylethoxy)-4-methoxyphenyl]-4-phenylbut-3-ynyl]guanidine |
| SMILES | COc1ccc(C(C#Cc2ccccc2)C/N=C(\N)NC#N)cc1OCCC1CCCCC1 |
| InChI | InChI=1S/C27H32N4O2/c1-32-25-15-14-23(18-26(25)33-17-16-22-10-6-3-7-11-22)24(19-30-27(29)31-20-28)13-12-21-8-4-2-5-9-21/h2,4-5,8-9,14-15,18,22,24H,3,6-7,10-11,16-17,19H2,1H3,(H3,29,30,31) |
| InChIKey | HTQRXTUPKQKLJN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|