C25H29NO3 — CID 54555142
3-(3-cyclopentyloxy-4-methoxyphenyl)-N,N-dimethyl-5-phenylpent-4-ynamide (PubChem CID 54555142) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)-N,N-dimethyl-5-phenylpent-4-ynamide.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-N,N-dimethyl-5-phenylpent-4-ynamide |
|---|---|
| PubChem CID | 54555142 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-N,N-dimethyl-5-phenylpent-4-ynamide |
| SMILES | COc1ccc(C(C#Cc2ccccc2)CC(=O)N(C)C)cc1OC1CCCC1 |
| InChI | InChI=1S/C25H29NO3/c1-26(2)25(27)18-21(14-13-19-9-5-4-6-10-19)20-15-16-23(28-3)24(17-20)29-22-11-7-8-12-22/h4-6,9-10,15-17,21-22H,7-8,11-12,18H2,1-3H3 |
| InChIKey | ZMQJLNKQIUCVLG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|