C30H28O6 — CID 19349943
methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-dibenzo-p-dioxin-2-ylpent-4-ynoate (PubChem CID 19349943) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-dibenzo-p-dioxin-2-ylpent-4-ynoate.
| Compound Name | methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-dibenzo-p-dioxin-2-ylpent-4-ynoate |
|---|---|
| PubChem CID | 19349943 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | methyl 3-(3-cyclopentyloxy-4-methoxyphenyl)-5-dibenzo-p-dioxin-2-ylpent-4-ynoate |
| SMILES | COC(=O)CC(C#Cc1ccc2c(c1)Oc1ccccc1O2)c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C30H28O6/c1-32-24-16-14-21(18-29(24)34-23-7-3-4-8-23)22(19-30(31)33-2)13-11-20-12-15-27-28(17-20)36-26-10-6-5-9-25(26)35-27/h5-6,9-10,12,14-18,22-23H,3-4,7-8,19H2,1-2H3 |
| InChIKey | ZLYVZUSVTMDHLT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|