C26H27N5O2 — CID 54381916
3-[5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]tetrazol-1-yl]propanenitrile (PubChem CID 54381916) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 3-[5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]tetrazol-1-yl]propanenitrile.
| Compound Name | 3-[5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]tetrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 54381916 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-[5-[2-(3-cyclopentyloxy-4-methoxyphenyl)-4-phenylbut-3-ynyl]tetrazol-1-yl]propanenitrile |
| SMILES | COc1ccc(C(C#Cc2ccccc2)Cc2nnnn2CCC#N)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H27N5O2/c1-32-24-15-14-21(18-25(24)33-23-10-5-6-11-23)22(13-12-20-8-3-2-4-9-20)19-26-28-29-30-31(26)17-7-16-27/h2-4,8-9,14-15,18,22-23H,5-7,10-11,17,19H2,1H3 |
| InChIKey | VAMWIZDONUDFFD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|