C14H22O2 — CID 70248546
2-methoxy-3-[(E)-5-methoxypent-1-enyl]-5-methylcyclohexa-1,3-diene (PubChem CID 70248546) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-methoxy-3-[(E)-5-methoxypent-1-enyl]-5-methylcyclohexa-1,3-diene.
| Compound Name | 2-methoxy-3-[(E)-5-methoxypent-1-enyl]-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70248546 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2-methoxy-3-[(E)-5-methoxypent-1-enyl]-5-methylcyclohexa-1,3-diene |
| SMILES | COCCC/C=C/C1=CC(C)CC=C1OC |
| InChI | InChI=1S/C14H22O2/c1-12-8-9-14(16-3)13(11-12)7-5-4-6-10-15-2/h5,7,9,11-12H,4,6,8,10H2,1-3H3/b7-5+ |
| InChIKey | HJNJGIRTNWSQLR-FNORWQNLSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|