C34H37IN2O4S — CID 70255231
[6-hydroxy-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]-[4-[2-(2-iodopyrrolidin-1-yl)ethoxy]phenyl]methanone (PubChem CID 70255231) has the molecular formula C34H37IN2O4S and a molecular weight of 696.65 g/mol. Its IUPAC name is [6-hydroxy-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]-[4-[2-(2-iodopyrrolidin-1-yl)ethoxy]phenyl]methanone.
| Compound Name | [6-hydroxy-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]-[4-[2-(2-iodopyrrolidin-1-yl)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 70255231 |
| Molecular Formula | C34H37IN2O4S |
| Molecular Weight | 696.65 g/mol |
| Exact Mass | 696.15 |
| IUPAC Name | [6-hydroxy-5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]-[4-[2-(2-iodopyrrolidin-1-yl)ethoxy]phenyl]methanone |
| SMILES | Cc1cc2c(C(=O)c3ccc(OCCN4CCCC4I)cc3)c(-c3ccc(OCCN4CCCC4)cc3)sc2cc1O |
| InChI | InChI=1S/C34H37IN2O4S/c1-23-21-28-30(22-29(23)38)42-34(25-8-12-27(13-9-25)40-19-17-36-14-2-3-15-36)32(28)33(39)24-6-10-26(11-7-24)41-20-18-37-16-4-5-31(37)35/h6-13,21-22,31,38H,2-5,14-20H2,1H3 |
| InChIKey | BOOIBTUZWPAYKR-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.65 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|