C13H19BrN2O4S2 — CID 70256800
tert-butyl (3R)-3-[(4-bromothiophen-3-yl)sulfonylamino]pyrrolidine-1-carboxylate (PubChem CID 70256800) has the molecular formula C13H19BrN2O4S2 and a molecular weight of 411.34 g/mol. Its IUPAC name is tert-butyl (3R)-3-[(4-bromothiophen-3-yl)sulfonylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[(4-bromothiophen-3-yl)sulfonylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 70256800 |
| Molecular Formula | C13H19BrN2O4S2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | tert-butyl (3R)-3-[(4-bromothiophen-3-yl)sulfonylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](NS(=O)(=O)c2cscc2Br)C1 |
| InChI | InChI=1S/C13H19BrN2O4S2/c1-13(2,3)20-12(17)16-5-4-9(6-16)15-22(18,19)11-8-21-7-10(11)14/h7-9,15H,4-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | XMCGDFKPZBXXAY-SECBINFHSA-N |
| XLogP | 2.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |