C26H30F3N5O6S — CID 70257116
2-[(2R)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-[(2R)-3-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)propanoyl]pyrrolidin-2-yl]acetic acid (PubChem CID 70257116) has the molecular formula C26H30F3N5O6S and a molecular weight of 597.62 g/mol. Its IUPAC name is 2-[(2R)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-[(2R)-3-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)propanoyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-[(2R)-3-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)propanoyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 70257116 |
| Molecular Formula | C26H30F3N5O6S |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 2-[(2R)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-1-[(2R)-3-phenyl-2-(2,2,2-trifluoroethylsulfonylamino)propanoyl]pyrrolidin-2-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@]2(CC(=O)O)CCCN2C(=O)[C@@H](Cc2ccccc2)NS(=O)(=O)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H30F3N5O6S/c27-26(28,29)16-41(39,40)33-20(13-17-5-2-1-3-6-17)23(37)34-12-4-11-25(34,14-21(35)36)24(38)32-15-18-7-9-19(10-8-18)22(30)31/h1-3,5-10,20,33H,4,11-16H2,(H3,30,31)(H,32,38)(H,35,36)/t20-,25-/m1/s1 |
| InChIKey | VVOGQIBPJLCCKI-CJFMBICVSA-N |
| XLogP | 1.52 |
| TPSA | 182.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|