C26H36N8O4S — CID 90714644
(2R)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-2-benzylsulfonyl-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 90714644) has the molecular formula C26H36N8O4S and a molecular weight of 556.69 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-2-benzylsulfonyl-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-2-benzylsulfonyl-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90714644 |
| Molecular Formula | C26H36N8O4S |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | (2R)-1-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]-2-benzylsulfonyl-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@]2(S(=O)(=O)Cc3ccccc3)CCCN2C(=O)[C@@H](N)CCCN=C(N)N)cc1 |
| InChI | InChI=1S/C26H36N8O4S/c27-21(8-4-14-32-25(30)31)23(35)34-15-5-13-26(34,39(37,38)17-19-6-2-1-3-7-19)24(36)33-16-18-9-11-20(12-10-18)22(28)29/h1-3,6-7,9-12,21H,4-5,8,13-17,27H2,(H3,28,29)(H,33,36)(H4,30,31,32)/t21-,26+/m0/s1 |
| InChIKey | PNTAMCZSPDGKQM-HFZDXXHNSA-N |
| XLogP | -0.10 |
| TPSA | 223.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|