C31H33Cl2N5O6S — CID 70065563
2-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-3,3-bis(4-chlorophenyl)-1-[(2S)-2-(methanesulfonamido)propanoyl]pyrrolidin-2-yl]acetic acid (PubChem CID 70065563) has the molecular formula C31H33Cl2N5O6S and a molecular weight of 674.61 g/mol. Its IUPAC name is 2-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-3,3-bis(4-chlorophenyl)-1-[(2S)-2-(methanesulfonamido)propanoyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-3,3-bis(4-chlorophenyl)-1-[(2S)-2-(methanesulfonamido)propanoyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 70065563 |
| Molecular Formula | C31H33Cl2N5O6S |
| Molecular Weight | 674.61 g/mol |
| Exact Mass | 673.15 |
| IUPAC Name | 2-[(2S)-2-[(4-carbamimidoylphenyl)methylcarbamoyl]-3,3-bis(4-chlorophenyl)-1-[(2S)-2-(methanesulfonamido)propanoyl]pyrrolidin-2-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@]2(CC(=O)O)N(C(=O)[C@H](C)NS(C)(=O)=O)CCC2(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C31H33Cl2N5O6S/c1-19(37-45(2,43)44)28(41)38-16-15-30(22-7-11-24(32)12-8-22,23-9-13-25(33)14-10-23)31(38,17-26(39)40)29(42)36-18-20-3-5-21(6-4-20)27(34)35/h3-14,19,37H,15-18H2,1-2H3,(H3,34,35)(H,36,42)(H,39,40)/t19-,31+/m0/s1 |
| InChIKey | GKOWIIRUIJGQRY-QPHCHLROSA-N |
| XLogP | 3.26 |
| TPSA | 182.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|