C22H16Cl4O2 — CID 70269742
1-chloro-4-[1-(4-chlorophenyl)ethenyl]benzene;2,2-dichloro-2-phenylacetic acid (PubChem CID 70269742) has the molecular formula C22H16Cl4O2 and a molecular weight of 454.18 g/mol. Its IUPAC name is 1-chloro-4-[1-(4-chlorophenyl)ethenyl]benzene;2,2-dichloro-2-phenylacetic acid.
| Compound Name | 1-chloro-4-[1-(4-chlorophenyl)ethenyl]benzene;2,2-dichloro-2-phenylacetic acid |
|---|---|
| PubChem CID | 70269742 |
| Molecular Formula | C22H16Cl4O2 |
| Molecular Weight | 454.18 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 1-chloro-4-[1-(4-chlorophenyl)ethenyl]benzene;2,2-dichloro-2-phenylacetic acid |
| SMILES | C=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1.O=C(O)C(Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2.C8H6Cl2O2/c1-10(11-2-6-13(15)7-3-11)12-4-8-14(16)9-5-12;9-8(10,7(11)12)6-4-2-1-3-5-6/h2-9H,1H2;1-5H,(H,11,12) |
| InChIKey | DDJRXABPHPMMCG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.18 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|