C8H16N2 — CID 70271171
[(2S)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-2-yl]methanamine (PubChem CID 70271171) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is [(2S)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-2-yl]methanamine.
| Compound Name | [(2S)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-2-yl]methanamine |
|---|---|
| PubChem CID | 70271171 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | [(2S)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-2-yl]methanamine |
| SMILES | NC[C@@H]1CC2CCCC2N1 |
| InChI | InChI=1S/C8H16N2/c9-5-7-4-6-2-1-3-8(6)10-7/h6-8,10H,1-5,9H2/t6?,7-,8?/m0/s1 |
| InChIKey | FHJKNPJFTIYTMS-WTIBDHCWSA-N |
| XLogP | 0.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |