C10H12N2O9 — CID 70273324
2-hydroxypropane-1,2,3-tricarboxylic acid;1H-pyrimidine-2,4-dione (PubChem CID 70273324) has the molecular formula C10H12N2O9 and a molecular weight of 304.21 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;1H-pyrimidine-2,4-dione.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70273324 |
| Molecular Formula | C10H12N2O9 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;1H-pyrimidine-2,4-dione |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H8O7.C4H4N2O2/c7-3(8)1-6(13,5(11)12)2-4(9)10;7-3-1-2-5-4(8)6-3/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1-2H,(H2,5,6,7,8) |
| InChIKey | KJCVIOHEHRONBO-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 197.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |