C12H10F2O2 — CID 70274115
4-(2,3-difluorophenyl)cyclohexa-2,4-diene-1,1-diol (PubChem CID 70274115) has the molecular formula C12H10F2O2 and a molecular weight of 224.21 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 4-(2,3-difluorophenyl)cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 70274115 |
| Molecular Formula | C12H10F2O2 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-(2,3-difluorophenyl)cyclohexa-2,4-diene-1,1-diol |
| SMILES | OC1(O)C=CC(c2cccc(F)c2F)=CC1 |
| InChI | InChI=1S/C12H10F2O2/c13-10-3-1-2-9(11(10)14)8-4-6-12(15,16)7-5-8/h1-6,15-16H,7H2 |
| InChIKey | LFBZVLWKRQUUKO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|