C22H35N5O2 — CID 70274548
1-N-[4-(diaminomethylideneamino)butyl]-1-N'-(2-methyl-1-phenylpropan-2-yl)cyclopentane-1,1-dicarboxamide (PubChem CID 70274548) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 1-N-[4-(diaminomethylideneamino)butyl]-1-N'-(2-methyl-1-phenylpropan-2-yl)cyclopentane-1,1-dicarboxamide.
| Compound Name | 1-N-[4-(diaminomethylideneamino)butyl]-1-N'-(2-methyl-1-phenylpropan-2-yl)cyclopentane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 70274548 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 1-N-[4-(diaminomethylideneamino)butyl]-1-N'-(2-methyl-1-phenylpropan-2-yl)cyclopentane-1,1-dicarboxamide |
| SMILES | CC(C)(Cc1ccccc1)NC(=O)C1(C(=O)NCCCCN=C(N)N)CCCC1 |
| InChI | InChI=1S/C22H35N5O2/c1-21(2,16-17-10-4-3-5-11-17)27-19(29)22(12-6-7-13-22)18(28)25-14-8-9-15-26-20(23)24/h3-5,10-11H,6-9,12-16H2,1-2H3,(H,25,28)(H,27,29)(H4,23,24,26) |
| InChIKey | HCTGCAZAPDQPRP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|