C34H49N3O10 — CID 70288586
[5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-(dihydroxyamino)oxybutanoate (PubChem CID 70288586) has the molecular formula C34H49N3O10 and a molecular weight of 659.78 g/mol. Its IUPAC name is [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-(dihydroxyamino)oxybutanoate.
| Compound Name | [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-(dihydroxyamino)oxybutanoate |
|---|---|
| PubChem CID | 70288586 |
| Molecular Formula | C34H49N3O10 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.34 |
| IUPAC Name | [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-(dihydroxyamino)oxybutanoate |
| SMILES | COCCCN1CCOc2ccc(COC3CNCC(OC(=O)CCCON(O)O)C3OC3CCC(Oc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C34H49N3O10/c1-41-18-6-16-36-17-20-42-30-15-10-25(21-29(30)36)24-43-31-22-35-23-32(47-33(38)9-5-19-44-37(39)40)34(31)46-28-13-11-27(12-14-28)45-26-7-3-2-4-8-26/h2-4,7-8,10,15,21,27-28,31-32,34-35,39-40H,5-6,9,11-14,16-20,22-24H2,1H3 |
| InChIKey | ZEBUTGCJINSBIF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|