C34H49N3O11 — CID 70289614
3-(dihydroxyamino)oxypropyl [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] carbonate (PubChem CID 70289614) has the molecular formula C34H49N3O11 and a molecular weight of 675.78 g/mol. Its IUPAC name is 3-(dihydroxyamino)oxypropyl [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] carbonate.
| Compound Name | 3-(dihydroxyamino)oxypropyl [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] carbonate |
|---|---|
| PubChem CID | 70289614 |
| Molecular Formula | C34H49N3O11 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 675.34 |
| IUPAC Name | 3-(dihydroxyamino)oxypropyl [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] carbonate |
| SMILES | COCCCN1CCOc2ccc(COC3CNCC(OC(=O)OCCCON(O)O)C3OC3CCC(Oc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C34H49N3O11/c1-41-17-5-15-36-16-20-42-30-14-9-25(21-29(30)36)24-44-31-22-35-23-32(48-34(38)43-18-6-19-45-37(39)40)33(31)47-28-12-10-27(11-13-28)46-26-7-3-2-4-8-26/h2-4,7-9,14,21,27-28,31-33,35,39-40H,5-6,10-13,15-20,22-24H2,1H3 |
| InChIKey | UVZYEBJIKSMUCO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|