C35H49N3O11 — CID 145497135
[5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-nitrooxybutyl carbonate (PubChem CID 145497135) has the molecular formula C35H49N3O11 and a molecular weight of 687.79 g/mol. Its IUPAC name is [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-nitrooxybutyl carbonate.
| Compound Name | [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-nitrooxybutyl carbonate |
|---|---|
| PubChem CID | 145497135 |
| Molecular Formula | C35H49N3O11 |
| Molecular Weight | 687.79 g/mol |
| Exact Mass | 687.34 |
| IUPAC Name | [5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]-4-(4-phenoxycyclohexyl)oxypiperidin-3-yl] 4-nitrooxybutyl carbonate |
| SMILES | COCCCN1CCOc2ccc(COC3CNCC(OC(=O)OCCCCO[N+](=O)[O-])C3OC3CCC(Oc4ccccc4)CC3)cc21 |
| InChI | InChI=1S/C35H49N3O11/c1-42-18-7-16-37-17-21-43-31-15-10-26(22-30(31)37)25-45-32-23-36-24-33(49-35(39)44-19-5-6-20-46-38(40)41)34(32)48-29-13-11-28(12-14-29)47-27-8-3-2-4-9-27/h2-4,8-10,15,22,28-29,32-34,36H,5-7,11-14,16-21,23-25H2,1H3 |
| InChIKey | LBJQDLOEDZQRHE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 149.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.79 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|