C21H22F2N2O — CID 70289635
N-[(4-ethoxy-2,3-difluorophenyl)methylideneamino]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine (PubChem CID 70289635) has the molecular formula C21H22F2N2O and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[(4-ethoxy-2,3-difluorophenyl)methylideneamino]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine.
| Compound Name | N-[(4-ethoxy-2,3-difluorophenyl)methylideneamino]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine |
|---|---|
| PubChem CID | 70289635 |
| Molecular Formula | C21H22F2N2O |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[(4-ethoxy-2,3-difluorophenyl)methylideneamino]-1-[4-[(E)-pent-3-enyl]phenyl]methanimine |
| SMILES | C/C=C/CCc1ccc(C=NN=Cc2ccc(OCC)c(F)c2F)cc1 |
| InChI | InChI=1S/C21H22F2N2O/c1-3-5-6-7-16-8-10-17(11-9-16)14-24-25-15-18-12-13-19(26-4-2)21(23)20(18)22/h3,5,8-15H,4,6-7H2,1-2H3/b5-3+,24-14?,25-15? |
| InChIKey | FCODMUSWJIWXFC-MFOXONGHSA-N |
| XLogP | 5.33 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|