C13H14Cl2O5 — CID 70292120
3,3-dichloro-4-oxo-2-phenoxy-4-propoxybutanoic acid (PubChem CID 70292120) has the molecular formula C13H14Cl2O5 and a molecular weight of 321.16 g/mol. Its IUPAC name is 3,3-dichloro-4-oxo-2-phenoxy-4-propoxybutanoic acid.
| Compound Name | 3,3-dichloro-4-oxo-2-phenoxy-4-propoxybutanoic acid |
|---|---|
| PubChem CID | 70292120 |
| Molecular Formula | C13H14Cl2O5 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3,3-dichloro-4-oxo-2-phenoxy-4-propoxybutanoic acid |
| SMILES | CCCOC(=O)C(Cl)(Cl)C(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H14Cl2O5/c1-2-8-19-12(18)13(14,15)10(11(16)17)20-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H,16,17) |
| InChIKey | MOFXVNSPOZKKKU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|