C40H52N2O8 — CID 70296235
[4-(4-dec-9-enoxyphenyl)phenyl] 2-amino-5-nitro-4-(3-octoxypropanoyloxy)benzoate (PubChem CID 70296235) has the molecular formula C40H52N2O8 and a molecular weight of 688.86 g/mol. Its IUPAC name is [4-(4-dec-9-enoxyphenyl)phenyl] 2-amino-5-nitro-4-(3-octoxypropanoyloxy)benzoate.
| Compound Name | [4-(4-dec-9-enoxyphenyl)phenyl] 2-amino-5-nitro-4-(3-octoxypropanoyloxy)benzoate |
|---|---|
| PubChem CID | 70296235 |
| Molecular Formula | C40H52N2O8 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | [4-(4-dec-9-enoxyphenyl)phenyl] 2-amino-5-nitro-4-(3-octoxypropanoyloxy)benzoate |
| SMILES | C=CCCCCCCCCOc1ccc(-c2ccc(OC(=O)c3cc([N+](=O)[O-])c(OC(=O)CCOCCCCCCCC)cc3N)cc2)cc1 |
| InChI | InChI=1S/C40H52N2O8/c1-3-5-7-9-11-12-14-16-27-48-33-21-17-31(18-22-33)32-19-23-34(24-20-32)49-40(44)35-29-37(42(45)46)38(30-36(35)41)50-39(43)25-28-47-26-15-13-10-8-6-4-2/h3,17-24,29-30H,1,4-16,25-28,41H2,2H3 |
| InChIKey | LJAMVXFRJCOGSW-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|