C19H20FNO — CID 70299435
5-fluoro-3-[(4-methoxy-3-propan-2-ylphenyl)methylidene]-1,2-dihydroindole (PubChem CID 70299435) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 5-fluoro-3-[(4-methoxy-3-propan-2-ylphenyl)methylidene]-1,2-dihydroindole.
| Compound Name | 5-fluoro-3-[(4-methoxy-3-propan-2-ylphenyl)methylidene]-1,2-dihydroindole |
|---|---|
| PubChem CID | 70299435 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-fluoro-3-[(4-methoxy-3-propan-2-ylphenyl)methylidene]-1,2-dihydroindole |
| SMILES | COc1ccc(C=C2CNc3ccc(F)cc32)cc1C(C)C |
| InChI | InChI=1S/C19H20FNO/c1-12(2)16-9-13(4-7-19(16)22-3)8-14-11-21-18-6-5-15(20)10-17(14)18/h4-10,12,21H,11H2,1-3H3 |
| InChIKey | BECYQZLHMGBGDA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|