C31H33NO3 — CID 70316415
1-[(4R)-4,5-dimethyl-4-(3-phenylmethoxyphenyl)-2-prop-2-enylpiperidin-1-yl]-2-phenylethane-1,2-dione (PubChem CID 70316415) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 1-[(4R)-4,5-dimethyl-4-(3-phenylmethoxyphenyl)-2-prop-2-enylpiperidin-1-yl]-2-phenylethane-1,2-dione.
| Compound Name | 1-[(4R)-4,5-dimethyl-4-(3-phenylmethoxyphenyl)-2-prop-2-enylpiperidin-1-yl]-2-phenylethane-1,2-dione |
|---|---|
| PubChem CID | 70316415 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 1-[(4R)-4,5-dimethyl-4-(3-phenylmethoxyphenyl)-2-prop-2-enylpiperidin-1-yl]-2-phenylethane-1,2-dione |
| SMILES | C=CCC1C[C@@](C)(c2cccc(OCc3ccccc3)c2)C(C)CN1C(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C31H33NO3/c1-4-12-27-20-31(3,23(2)21-32(27)30(34)29(33)25-15-9-6-10-16-25)26-17-11-18-28(19-26)35-22-24-13-7-5-8-14-24/h4-11,13-19,23,27H,1,12,20-22H2,2-3H3/t23?,27?,31-/m1/s1 |
| InChIKey | BBKRVYWTRPIELZ-XBPDSQQVSA-N |
| XLogP | 6.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|