C25H29F2N5O3 — CID 70316906
6-(3,4-difluorophenyl)-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-(2-propan-2-yloxyethyl)pyrido[2,3-b]pyrazin-3-one (PubChem CID 70316906) has the molecular formula C25H29F2N5O3 and a molecular weight of 485.54 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-(2-propan-2-yloxyethyl)pyrido[2,3-b]pyrazin-3-one.
| Compound Name | 6-(3,4-difluorophenyl)-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-(2-propan-2-yloxyethyl)pyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 70316906 |
| Molecular Formula | C25H29F2N5O3 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 6-(3,4-difluorophenyl)-2-[3-(2-oxopyrrolidin-1-yl)propylamino]-4-(2-propan-2-yloxyethyl)pyrido[2,3-b]pyrazin-3-one |
| SMILES | CC(C)OCCn1c(=O)c(NCCCN2CCCC2=O)nc2ccc(-c3ccc(F)c(F)c3)nc21 |
| InChI | InChI=1S/C25H29F2N5O3/c1-16(2)35-14-13-32-24-21(9-8-20(30-24)17-6-7-18(26)19(27)15-17)29-23(25(32)34)28-10-4-12-31-11-3-5-22(31)33/h6-9,15-16H,3-5,10-14H2,1-2H3,(H,28,29) |
| InChIKey | BRFZIHWXWSUNRC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|