C25H30N8OS2 — CID 70321725
2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide (PubChem CID 70321725) has the molecular formula C25H30N8OS2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide.
| Compound Name | 2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 70321725 |
| Molecular Formula | C25H30N8OS2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide |
| SMILES | C=C(CNCCC1(c2nn[nH]n2)c2ccsc2CCc2sc(C(=O)N(C)C)cc21)N1CCCC1C#N |
| InChI | InChI=1S/C25H30N8OS2/c1-16(33-11-4-5-17(33)14-26)15-27-10-9-25(24-28-30-31-29-24)18-8-12-35-20(18)6-7-21-19(25)13-22(36-21)23(34)32(2)3/h8,12-13,17,27H,1,4-7,9-11,15H2,2-3H3,(H,28,29,30,31) |
| InChIKey | KCZVDVMKLZUVLV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|