C23H25N9O3S2 — CID 70647624
2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide (PubChem CID 70647624) has the molecular formula C23H25N9O3S2 and a molecular weight of 539.65 g/mol. Its IUPAC name is 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide.
| Compound Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide |
|---|---|
| PubChem CID | 70647624 |
| Molecular Formula | C23H25N9O3S2 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5,12-dicarboxamide |
| SMILES | N#CC1CCCN1C(=O)CNCCC1(c2nn[nH]n2)c2cc(C(N)=O)sc2CCc2sc(C(N)=O)cc21 |
| InChI | InChI=1S/C23H25N9O3S2/c24-10-12-2-1-7-32(12)19(33)11-27-6-5-23(22-28-30-31-29-22)13-8-17(20(25)34)36-15(13)3-4-16-14(23)9-18(37-16)21(26)35/h8-9,12,27H,1-7,11H2,(H2,25,34)(H2,26,35)(H,28,29,30,31) |
| InChIKey | YPIATAWRQOFUDY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 196.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|