C34H33FN8O3 — CID 70647571
2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide (PubChem CID 70647571) has the molecular formula C34H33FN8O3 and a molecular weight of 620.69 g/mol. Its IUPAC name is 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide.
| Compound Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
|---|---|
| PubChem CID | 70647571 |
| Molecular Formula | C34H33FN8O3 |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-2-[3-(4-fluorophenyl)-1H-1,2,4-triazol-5-yl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
| SMILES | N#CC1CCCN1C(=O)CNCCC1(c2nc(-c3ccc(F)cc3)n[nH]2)c2ccc(C(N)=O)cc2CCc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C34H33FN8O3/c35-25-9-5-20(6-10-25)32-40-33(42-41-32)34(13-14-39-19-29(44)43-15-1-2-26(43)18-36)27-11-7-23(30(37)45)16-21(27)3-4-22-17-24(31(38)46)8-12-28(22)34/h5-12,16-17,26,39H,1-4,13-15,19H2,(H2,37,45)(H2,38,46)(H,40,41,42) |
| InChIKey | XOZSSIMZIOSXLD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 183.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|