C27H33N9O3 — CID 90222221
2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-[(Z)-N'-hydrazinylcarbamimidoyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide (PubChem CID 90222221) has the molecular formula C27H33N9O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-[(Z)-N'-hydrazinylcarbamimidoyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide.
| Compound Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-[(Z)-N'-hydrazinylcarbamimidoyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
|---|---|
| PubChem CID | 90222221 |
| Molecular Formula | C27H33N9O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-2-[(Z)-N'-hydrazinylcarbamimidoyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNCCC1(/C(N)=N/NN)c2ccc(C(N)=O)cc2CCc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C27H33N9O3/c28-14-20-2-1-11-36(20)23(37)15-33-10-9-27(26(31)34-35-32)21-7-5-18(24(29)38)12-16(21)3-4-17-13-19(25(30)39)6-8-22(17)27/h5-8,12-13,20,33,35H,1-4,9-11,15,32H2,(H2,29,38)(H2,30,39)(H2,31,34)/t20-/m0/s1 |
| InChIKey | FYIQUJZDENMJSP-FQEVSTJZSA-N |
| XLogP | -0.50 |
| TPSA | 218.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|