C31H39N7O — CID 70319862
2-carbamimidoyl-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N-methyl-13-[1-(methylamino)ethenyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide (PubChem CID 70319862) has the molecular formula C31H39N7O and a molecular weight of 525.70 g/mol. Its IUPAC name is 2-carbamimidoyl-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N-methyl-13-[1-(methylamino)ethenyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide.
| Compound Name | 2-carbamimidoyl-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N-methyl-13-[1-(methylamino)ethenyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 70319862 |
| Molecular Formula | C31H39N7O |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 2-carbamimidoyl-2-[2-[2-(2-cyanopyrrolidin-1-yl)prop-2-enylamino]ethyl]-N-methyl-13-[1-(methylamino)ethenyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
| SMILES | [H]/N=C(\N)C1(CCNCC(=C)N2CCCC2C#N)c2ccc(C(=C)NC)cc2CCc2cc(C(=O)NC)ccc21 |
| InChI | InChI=1S/C31H39N7O/c1-20(38-15-5-6-26(38)18-32)19-37-14-13-31(30(33)34)27-11-9-22(21(2)35-3)16-23(27)7-8-24-17-25(29(39)36-4)10-12-28(24)31/h9-12,16-17,26,35,37H,1-2,5-8,13-15,19H2,3-4H3,(H3,33,34)(H,36,39) |
| InChIKey | SVKQDKSLKSQLGY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|