C32H37N7O4 — CID 70647157
2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,13-N,13-N-trimethyl-2-(5-methyl-1,3,4-oxadiazol-2-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide (PubChem CID 70647157) has the molecular formula C32H37N7O4 and a molecular weight of 583.69 g/mol. Its IUPAC name is 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,13-N,13-N-trimethyl-2-(5-methyl-1,3,4-oxadiazol-2-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide.
| Compound Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,13-N,13-N-trimethyl-2-(5-methyl-1,3,4-oxadiazol-2-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
|---|---|
| PubChem CID | 70647157 |
| Molecular Formula | C32H37N7O4 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.29 |
| IUPAC Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,13-N,13-N-trimethyl-2-(5-methyl-1,3,4-oxadiazol-2-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)CCc1cc(C(=O)N(C)C)ccc1C2(CCNCC(=O)N1CCCC1C#N)c1nnc(C)o1 |
| InChI | InChI=1S/C32H37N7O4/c1-20-36-37-31(43-20)32(13-14-35-19-28(40)39-15-5-6-25(39)18-33)26-11-9-23(29(41)34-2)16-21(26)7-8-22-17-24(10-12-27(22)32)30(42)38(3)4/h9-12,16-17,25,35H,5-8,13-15,19H2,1-4H3,(H,34,41) |
| InChIKey | LXDAYYGYTHIODP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|