C32H39N7O3 — CID 143318863
6-[(1Z,3Z)-5-amino-3-ethylidenehexa-1,5-dienyl]-5-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-8,9-dihydrobenzo[7]annulene-2-carboxamide (PubChem CID 143318863) has the molecular formula C32H39N7O3 and a molecular weight of 569.71 g/mol. Its IUPAC name is 6-[(1Z,3Z)-5-amino-3-ethylidenehexa-1,5-dienyl]-5-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-8,9-dihydrobenzo[7]annulene-2-carboxamide.
| Compound Name | 6-[(1Z,3Z)-5-amino-3-ethylidenehexa-1,5-dienyl]-5-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-8,9-dihydrobenzo[7]annulene-2-carboxamide |
|---|---|
| PubChem CID | 143318863 |
| Molecular Formula | C32H39N7O3 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | 6-[(1Z,3Z)-5-amino-3-ethylidenehexa-1,5-dienyl]-5-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-5-(5-methyl-1,3,4-oxadiazol-2-yl)-8,9-dihydrobenzo[7]annulene-2-carboxamide |
| SMILES | C=C(N)CC(/C=C\C1=CCCc2cc(C(N)=O)ccc2C1(CCNCC(=O)N1CCCC1C#N)c1nnc(C)o1)=C/C |
| InChI | InChI=1S/C32H39N7O3/c1-4-23(17-21(2)34)10-12-26-8-5-7-24-18-25(30(35)41)11-13-28(24)32(26,31-38-37-22(3)42-31)14-15-36-20-29(40)39-16-6-9-27(39)19-33/h4,8,10-13,18,27,36H,2,5-7,9,14-17,20,34H2,1,3H3,(H2,35,41)/b12-10-,23-4+ |
| InChIKey | QDBJWBLVNSYAIA-QLVRXIGRSA-N |
| XLogP | 3.49 |
| TPSA | 164.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|