C29H34N6O2 — CID 143416045
13-(1-aminoethenyl)-2-[2-[2-[(2S)-2-cyanopyrrolidin-1-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide (PubChem CID 143416045) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 13-(1-aminoethenyl)-2-[2-[2-[(2S)-2-cyanopyrrolidin-1-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide.
| Compound Name | 13-(1-aminoethenyl)-2-[2-[2-[(2S)-2-cyanopyrrolidin-1-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 143416045 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 13-(1-aminoethenyl)-2-[2-[2-[(2S)-2-cyanopyrrolidin-1-yl]prop-2-enylamino]ethyl]tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2,6-dicarboxamide |
| SMILES | C=C(N)c1ccc2c(c1)CCc1cc(C(N)=O)ccc1C2(CCNCC(=C)N1CCC[C@H]1C#N)C(N)=O |
| InChI | InChI=1S/C29H34N6O2/c1-18(35-13-3-4-24(35)16-30)17-34-12-11-29(28(33)37)25-9-7-20(19(2)31)14-21(25)5-6-22-15-23(27(32)36)8-10-26(22)29/h7-10,14-15,24,34H,1-6,11-13,17,31H2,(H2,32,36)(H2,33,37)/t24-,29?/m0/s1 |
| InChIKey | MMQDBJJEMSBRGF-CTLOQAHHSA-N |
| XLogP | 2.07 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|