C31H39N7O3 — CID 70647543
2-carbamimidoyl-2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide (PubChem CID 70647543) has the molecular formula C31H39N7O3 and a molecular weight of 557.70 g/mol. Its IUPAC name is 2-carbamimidoyl-2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide.
| Compound Name | 2-carbamimidoyl-2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
|---|---|
| PubChem CID | 70647543 |
| Molecular Formula | C31H39N7O3 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | 2-carbamimidoyl-2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-6-N,6-N,13-N,13-N-tetramethyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6,13-dicarboxamide |
| SMILES | [H]/N=C(\N)C1(CCNCC(=O)N2CCCC2C#N)c2ccc(C(=O)N(C)C)cc2CCc2cc(C(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C31H39N7O3/c1-36(2)28(40)22-9-11-25-20(16-22)7-8-21-17-23(29(41)37(3)4)10-12-26(21)31(25,30(33)34)13-14-35-19-27(39)38-15-5-6-24(38)18-32/h9-12,16-17,24,35H,5-8,13-15,19H2,1-4H3,(H3,33,34) |
| InChIKey | UPOLMSBQRDUWOG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|