C26H29FN4O2 — CID 70646927
2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-5-fluoro-13-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2-carboxamide (PubChem CID 70646927) has the molecular formula C26H29FN4O2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-5-fluoro-13-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2-carboxamide.
| Compound Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-5-fluoro-13-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2-carboxamide |
|---|---|
| PubChem CID | 70646927 |
| Molecular Formula | C26H29FN4O2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-5-fluoro-13-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-2-carboxamide |
| SMILES | Cc1ccc2c(c1)CCc1ccc(F)cc1C2(CCNCC(=O)N1CCC[C@H]1C#N)C(N)=O |
| InChI | InChI=1S/C26H29FN4O2/c1-17-4-9-22-19(13-17)6-5-18-7-8-20(27)14-23(18)26(22,25(29)33)10-11-30-16-24(32)31-12-2-3-21(31)15-28/h4,7-9,13-14,21,30H,2-3,5-6,10-12,16H2,1H3,(H2,29,33)/t21-,26?/m0/s1 |
| InChIKey | DHDZWLNIYJTZOS-GVNKFJBHSA-N |
| XLogP | 2.50 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|