C26H27FN8O2 — CID 70646532
2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-13-fluoro-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide (PubChem CID 70646532) has the molecular formula C26H27FN8O2 and a molecular weight of 502.55 g/mol. Its IUPAC name is 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-13-fluoro-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide.
| Compound Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-13-fluoro-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 70646532 |
| Molecular Formula | C26H27FN8O2 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[2-[[2-(2-cyanopyrrolidin-1-yl)-2-oxoethyl]amino]ethyl]-13-fluoro-2-(2H-tetrazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
| SMILES | N#CC1CCCN1C(=O)CNCCC1(c2nn[nH]n2)c2ccc(F)cc2CCc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C26H27FN8O2/c27-19-6-8-22-17(13-19)4-3-16-12-18(24(29)37)5-7-21(16)26(22,25-31-33-34-32-25)9-10-30-15-23(36)35-11-1-2-20(35)14-28/h5-8,12-13,20,30H,1-4,9-11,15H2,(H2,29,37)(H,31,32,33,34) |
| InChIKey | KDZMBGABOWUMPY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|