C31H35N7O3 — CID 58253593
2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N-methyl-13-propanoyl-2-(3H-1,2,4-triazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide (PubChem CID 58253593) has the molecular formula C31H35N7O3 and a molecular weight of 553.67 g/mol. Its IUPAC name is 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N-methyl-13-propanoyl-2-(3H-1,2,4-triazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide.
| Compound Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N-methyl-13-propanoyl-2-(3H-1,2,4-triazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
|---|---|
| PubChem CID | 58253593 |
| Molecular Formula | C31H35N7O3 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N-methyl-13-propanoyl-2-(3H-1,2,4-triazol-5-yl)tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene-6-carboxamide |
| SMILES | CCC(=O)c1ccc2c(c1)CCc1cc(C(=O)NC)ccc1C2(CCNCC(=O)N1CCC[C@H]1C#N)C1=NCN=N1 |
| InChI | InChI=1S/C31H35N7O3/c1-3-27(39)22-8-10-25-20(15-22)6-7-21-16-23(29(41)33-2)9-11-26(21)31(25,30-35-19-36-37-30)12-13-34-18-28(40)38-14-4-5-24(38)17-32/h8-11,15-16,24,34H,3-7,12-14,18-19H2,1-2H3,(H,33,41)/t24-,31?/m0/s1 |
| InChIKey | WLUVUWDNPPKZER-ACXKHFGCSA-N |
| XLogP | 3.34 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|