C24H28N8O2S2 — CID 58253763
2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide (PubChem CID 58253763) has the molecular formula C24H28N8O2S2 and a molecular weight of 524.68 g/mol. Its IUPAC name is 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide.
| Compound Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 58253763 |
| Molecular Formula | C24H28N8O2S2 |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[2-[[2-[(2S)-2-cyanopyrrolidin-1-yl]-2-oxoethyl]amino]ethyl]-N,N-dimethyl-2-(2H-tetrazol-5-yl)-6,11-dithiatricyclo[8.3.0.03,7]trideca-1(10),3(7),4,12-tetraene-5-carboxamide |
| SMILES | CN(C)C(=O)c1cc2c(s1)CCc1sccc1C2(CCNCC(=O)N1CCC[C@H]1C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C24H28N8O2S2/c1-31(2)22(34)20-12-17-19(36-20)6-5-18-16(7-11-35-18)24(17,23-27-29-30-28-23)8-9-26-14-21(33)32-10-3-4-15(32)13-25/h7,11-12,15,26H,3-6,8-10,14H2,1-2H3,(H,27,28,29,30)/t15-,24?/m0/s1 |
| InChIKey | ZEZYBJNAFFTVRS-FZADBTJQSA-N |
| XLogP | 1.95 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|