C30H44FN3O5S — CID 70328647
tert-butyl (2S)-2-[(2S)-2-amino-3-(3-fluoro-5-pentoxyphenyl)propyl]-4-(3-methylphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 70328647) has the molecular formula C30H44FN3O5S and a molecular weight of 577.76 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2S)-2-amino-3-(3-fluoro-5-pentoxyphenyl)propyl]-4-(3-methylphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2S)-2-amino-3-(3-fluoro-5-pentoxyphenyl)propyl]-4-(3-methylphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 70328647 |
| Molecular Formula | C30H44FN3O5S |
| Molecular Weight | 577.76 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | tert-butyl (2S)-2-[(2S)-2-amino-3-(3-fluoro-5-pentoxyphenyl)propyl]-4-(3-methylphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CCCCCOc1cc(F)cc(C[C@H](N)C[C@H]2CN(S(=O)(=O)c3cccc(C)c3)CCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C30H44FN3O5S/c1-6-7-8-14-38-27-18-23(16-24(31)19-27)17-25(32)20-26-21-33(12-13-34(26)29(35)39-30(3,4)5)40(36,37)28-11-9-10-22(2)15-28/h9-11,15-16,18-19,25-26H,6-8,12-14,17,20-21,32H2,1-5H3/t25-,26-/m0/s1 |
| InChIKey | PDQOURXXTBHFAK-UIOOFZCWSA-N |
| XLogP | 5.27 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|