C27H40FN3O4S — CID 143178236
N-[(2S)-1-(3-fluoro-5-pentoxyphenyl)-4-[2-[methyl-(3-methylphenyl)sulfonylamino]ethylamino]butan-2-yl]acetamide (PubChem CID 143178236) has the molecular formula C27H40FN3O4S and a molecular weight of 521.70 g/mol. Its IUPAC name is N-[(2S)-1-(3-fluoro-5-pentoxyphenyl)-4-[2-[methyl-(3-methylphenyl)sulfonylamino]ethylamino]butan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-(3-fluoro-5-pentoxyphenyl)-4-[2-[methyl-(3-methylphenyl)sulfonylamino]ethylamino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 143178236 |
| Molecular Formula | C27H40FN3O4S |
| Molecular Weight | 521.70 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | N-[(2S)-1-(3-fluoro-5-pentoxyphenyl)-4-[2-[methyl-(3-methylphenyl)sulfonylamino]ethylamino]butan-2-yl]acetamide |
| SMILES | CCCCCOc1cc(F)cc(C[C@@H](CCNCCN(C)S(=O)(=O)c2cccc(C)c2)NC(C)=O)c1 |
| InChI | InChI=1S/C27H40FN3O4S/c1-5-6-7-15-35-26-19-23(17-24(28)20-26)18-25(30-22(3)32)11-12-29-13-14-31(4)36(33,34)27-10-8-9-21(2)16-27/h8-10,16-17,19-20,25,29H,5-7,11-15,18H2,1-4H3,(H,30,32)/t25-/m1/s1 |
| InChIKey | GNSCRYJLMWAEQQ-RUZDIDTESA-N |
| XLogP | 4.05 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.70 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|