C26H41N3O4S — CID 70330718
(Z)-3-[5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylphenyl]-2-(methylamino)-N-[2-(oxan-4-yl)ethyl]but-2-enamide (PubChem CID 70330718) has the molecular formula C26H41N3O4S and a molecular weight of 491.70 g/mol. Its IUPAC name is (Z)-3-[5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylphenyl]-2-(methylamino)-N-[2-(oxan-4-yl)ethyl]but-2-enamide.
| Compound Name | (Z)-3-[5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylphenyl]-2-(methylamino)-N-[2-(oxan-4-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 70330718 |
| Molecular Formula | C26H41N3O4S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | (Z)-3-[5-(3,5-dimethylpiperidin-1-yl)sulfonyl-2-methylphenyl]-2-(methylamino)-N-[2-(oxan-4-yl)ethyl]but-2-enamide |
| SMILES | CN/C(C(=O)NCCC1CCOCC1)=C(/C)c1cc(S(=O)(=O)N2CC(C)CC(C)C2)ccc1C |
| InChI | InChI=1S/C26H41N3O4S/c1-18-14-19(2)17-29(16-18)34(31,32)23-7-6-20(3)24(15-23)21(4)25(27-5)26(30)28-11-8-22-9-12-33-13-10-22/h6-7,15,18-19,22,27H,8-14,16-17H2,1-5H3,(H,28,30)/b25-21- |
| InChIKey | UVZNGKAYFBJELU-DAFNUICNSA-N |
| XLogP | 3.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|