C24H33N7O — CID 70339849
4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-8-yl]-ethylamino]phenol (PubChem CID 70339849) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-8-yl]-ethylamino]phenol.
| Compound Name | 4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-8-yl]-ethylamino]phenol |
|---|---|
| PubChem CID | 70339849 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 4-[[2-[(4-aminocyclohexyl)amino]-9-cyclopentylpurin-8-yl]-ethylamino]phenol |
| SMILES | CCN(c1ccc(O)cc1)c1nc2cnc(NC3CCC(N)CC3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C24H33N7O/c1-2-30(18-11-13-20(32)14-12-18)24-28-21-15-26-23(27-17-9-7-16(25)8-10-17)29-22(21)31(24)19-5-3-4-6-19/h11-17,19,32H,2-10,25H2,1H3,(H,26,27,29) |
| InChIKey | WDUSADOFMZRCMN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |