C25H35N5O2Sn — CID 70347355
butyl 3-[[4-(5-trimethylstannyl-2-pyridinyl)piperazin-1-yl]methyl]pyrrolo[2,3-b]pyridine-1-carboxylate (PubChem CID 70347355) has the molecular formula C25H35N5O2Sn and a molecular weight of 556.30 g/mol. Its IUPAC name is butyl 3-[[4-(5-trimethylstannyl-2-pyridinyl)piperazin-1-yl]methyl]pyrrolo[2,3-b]pyridine-1-carboxylate.
| Compound Name | butyl 3-[[4-(5-trimethylstannyl-2-pyridinyl)piperazin-1-yl]methyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 70347355 |
| Molecular Formula | C25H35N5O2Sn |
| Molecular Weight | 556.30 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | butyl 3-[[4-(5-trimethylstannyl-2-pyridinyl)piperazin-1-yl]methyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
| SMILES | CCCCOC(=O)n1cc(CN2CCN(c3ccc([Sn](C)(C)C)cn3)CC2)c2cccnc21 |
| InChI | InChI=1S/C22H26N5O2.3CH3.Sn/c1-2-3-15-29-22(28)27-17-18(19-7-6-10-24-21(19)27)16-25-11-13-26(14-12-25)20-8-4-5-9-23-20;;;;/h4,6-10,17H,2-3,11-16H2,1H3;3*1H3; |
| InChIKey | DAJYAGPIIILRNY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|