C32H39BrO3 — CID 70347655
3-bromo-2-[4-[4-(2-methylbutoxy)phenyl]phenyl]-4-octylbenzoic acid (PubChem CID 70347655) has the molecular formula C32H39BrO3 and a molecular weight of 551.57 g/mol. Its IUPAC name is 3-bromo-2-[4-[4-(2-methylbutoxy)phenyl]phenyl]-4-octylbenzoic acid.
| Compound Name | 3-bromo-2-[4-[4-(2-methylbutoxy)phenyl]phenyl]-4-octylbenzoic acid |
|---|---|
| PubChem CID | 70347655 |
| Molecular Formula | C32H39BrO3 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 3-bromo-2-[4-[4-(2-methylbutoxy)phenyl]phenyl]-4-octylbenzoic acid |
| SMILES | CCCCCCCCc1ccc(C(=O)O)c(-c2ccc(-c3ccc(OCC(C)CC)cc3)cc2)c1Br |
| InChI | InChI=1S/C32H39BrO3/c1-4-6-7-8-9-10-11-27-18-21-29(32(34)35)30(31(27)33)26-14-12-24(13-15-26)25-16-19-28(20-17-25)36-22-23(3)5-2/h12-21,23H,4-11,22H2,1-3H3,(H,34,35) |
| InChIKey | JIBYQCJHQFQCGD-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|