C27H35FO5 — CID 70358701
3-fluoro-2-[4-(2-methylbutoxycarbonyl)phenyl]-4-octoxybenzoic acid (PubChem CID 70358701) has the molecular formula C27H35FO5 and a molecular weight of 458.57 g/mol. Its IUPAC name is 3-fluoro-2-[4-(2-methylbutoxycarbonyl)phenyl]-4-octoxybenzoic acid.
| Compound Name | 3-fluoro-2-[4-(2-methylbutoxycarbonyl)phenyl]-4-octoxybenzoic acid |
|---|---|
| PubChem CID | 70358701 |
| Molecular Formula | C27H35FO5 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 3-fluoro-2-[4-(2-methylbutoxycarbonyl)phenyl]-4-octoxybenzoic acid |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)c(-c2ccc(C(=O)OCC(C)CC)cc2)c1F |
| InChI | InChI=1S/C27H35FO5/c1-4-6-7-8-9-10-17-32-23-16-15-22(26(29)30)24(25(23)28)20-11-13-21(14-12-20)27(31)33-18-19(3)5-2/h11-16,19H,4-10,17-18H2,1-3H3,(H,29,30) |
| InChIKey | IIHADFRHGYOWPA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|