C11H24O4 — CID 70350991
1-methylcyclohexane-1,4-diol;2-methylpropane-1,3-diol (PubChem CID 70350991) has the molecular formula C11H24O4 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-methylcyclohexane-1,4-diol;2-methylpropane-1,3-diol.
| Compound Name | 1-methylcyclohexane-1,4-diol;2-methylpropane-1,3-diol |
|---|---|
| PubChem CID | 70350991 |
| Molecular Formula | C11H24O4 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | 1-methylcyclohexane-1,4-diol;2-methylpropane-1,3-diol |
| SMILES | CC(CO)CO.CC1(O)CCC(O)CC1 |
| InChI | InChI=1S/C7H14O2.C4H10O2/c1-7(9)4-2-6(8)3-5-7;1-4(2-5)3-6/h6,8-9H,2-5H2,1H3;4-6H,2-3H2,1H3 |
| InChIKey | BMUDQRGQZBGGPG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |