C19H20N2 — CID 70354544
2,3-diphenyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyridine (PubChem CID 70354544) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2,3-diphenyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyridine.
| Compound Name | 2,3-diphenyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 70354544 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2,3-diphenyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyridine |
| SMILES | C1=C2NC(c3ccccc3)C(c3ccccc3)N2CCC1 |
| InChI | InChI=1S/C19H20N2/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)21-14-8-7-13-17(21)20-18/h1-6,9-13,18-20H,7-8,14H2 |
| InChIKey | QSCLEMMBGHJSPC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |