C34H34N2O — CID 70355656
(5aS,10bS)-9-methoxy-5,5a,6,10b-tetrahydroindeno[2,1-b]indole;(5aS,10bS)-9-propan-2-yl-5,5a,6,10b-tetrahydroindeno[2,1-b]indole (PubChem CID 70355656) has the molecular formula C34H34N2O and a molecular weight of 486.66 g/mol. Its IUPAC name is (5aS,10bS)-9-methoxy-5,5a,6,10b-tetrahydroindeno[2,1-b]indole;(5aS,10bS)-9-propan-2-yl-5,5a,6,10b-tetrahydroindeno[2,1-b]indole.
| Compound Name | (5aS,10bS)-9-methoxy-5,5a,6,10b-tetrahydroindeno[2,1-b]indole;(5aS,10bS)-9-propan-2-yl-5,5a,6,10b-tetrahydroindeno[2,1-b]indole |
|---|---|
| PubChem CID | 70355656 |
| Molecular Formula | C34H34N2O |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (5aS,10bS)-9-methoxy-5,5a,6,10b-tetrahydroindeno[2,1-b]indole;(5aS,10bS)-9-propan-2-yl-5,5a,6,10b-tetrahydroindeno[2,1-b]indole |
| SMILES | CC(C)c1ccc2c(c1)[C@H]1c3ccccc3N[C@H]1C2.COc1ccc2c(c1)[C@H]1c3ccccc3N[C@H]1C2 |
| InChI | InChI=1S/C18H19N.C16H15NO/c1-11(2)12-7-8-13-10-17-18(15(13)9-12)14-5-3-4-6-16(14)19-17;1-18-11-7-6-10-8-15-16(13(10)9-11)12-4-2-3-5-14(12)17-15/h3-9,11,17-19H,10H2,1-2H3;2-7,9,15-17H,8H2,1H3/t17-,18+;15-,16+/m00/s1 |
| InChIKey | RUXBJNXPLISIAU-WQFFCJPNSA-N |
| XLogP | 7.47 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |