C25H21NO5S — CID 70361059
N-[2-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-(4-hydroxy-2H-thiochromen-3-yl)-2-oxoacetamide (PubChem CID 70361059) has the molecular formula C25H21NO5S and a molecular weight of 447.51 g/mol. Its IUPAC name is N-[2-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-(4-hydroxy-2H-thiochromen-3-yl)-2-oxoacetamide.
| Compound Name | N-[2-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-(4-hydroxy-2H-thiochromen-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 70361059 |
| Molecular Formula | C25H21NO5S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[2-[2-(3,4-dihydroxyphenyl)ethyl]phenyl]-2-(4-hydroxy-2H-thiochromen-3-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1ccccc1CCc1ccc(O)c(O)c1)C(=O)C1=C(O)c2ccccc2SC1 |
| InChI | InChI=1S/C25H21NO5S/c27-20-12-10-15(13-21(20)28)9-11-16-5-1-3-7-19(16)26-25(31)24(30)18-14-32-22-8-4-2-6-17(22)23(18)29/h1-8,10,12-13,27-29H,9,11,14H2,(H,26,31) |
| InChIKey | MIKUEDKDIKRPNE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|