C36H32Cl2N2O7 — CID 70374569
bis(10-benzyl-5-chloro-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-1-yl) oxalate;hydrate (PubChem CID 70374569) has the molecular formula C36H32Cl2N2O7 and a molecular weight of 675.57 g/mol. Its IUPAC name is bis(10-benzyl-5-chloro-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-1-yl) oxalate;hydrate.
| Compound Name | bis(10-benzyl-5-chloro-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-1-yl) oxalate;hydrate |
|---|---|
| PubChem CID | 70374569 |
| Molecular Formula | C36H32Cl2N2O7 |
| Molecular Weight | 675.57 g/mol |
| Exact Mass | 674.16 |
| IUPAC Name | bis(10-benzyl-5-chloro-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-1-yl) oxalate;hydrate |
| SMILES | O.O=C(OC12CN(Cc3ccccc3)CC(O1)c1cc(Cl)ccc12)C(=O)OC12CN(Cc3ccccc3)CC(O1)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C36H30Cl2N2O6.H2O/c37-25-11-13-29-27(15-25)31-19-39(17-23-7-3-1-4-8-23)21-35(29,43-31)45-33(41)34(42)46-36-22-40(18-24-9-5-2-6-10-24)20-32(44-36)28-16-26(38)12-14-30(28)36;/h1-16,31-32H,17-22H2;1H2 |
| InChIKey | KYNQDDXGTUSVNL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 109.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|